C15H25N5O — CID 110970995
N-butan-2-yl-3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propanamide (PubChem CID 110970995) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 110970995 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | N-butan-2-yl-3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propanamide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)NCc1ccccn1 |
| InChI | InChI=1S/C15H25N5O/c1-4-12(2)20-14(21)8-10-18-15(16-3)19-11-13-7-5-6-9-17-13/h5-7,9,12H,4,8,10-11H2,1-3H3,(H,20,21)(H2,16,18,19) |
| InChIKey | AUGDSYKVEBTLKK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|