C17H30IN5O — CID 111192051
N-butan-2-yl-3-[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]propanamide;hydroiodide (PubChem CID 111192051) has the molecular formula C17H30IN5O and a molecular weight of 447.37 g/mol. Its IUPAC name is N-butan-2-yl-3-[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]propanamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111192051 |
| Molecular Formula | C17H30IN5O |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-butan-2-yl-3-[[ethylamino-(2-pyridin-2-ylethylamino)methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC(C)CC)NCCc1ccccn1.I |
| InChI | InChI=1S/C17H29N5O.HI/c1-4-14(3)22-16(23)10-13-21-17(18-5-2)20-12-9-15-8-6-7-11-19-15;/h6-8,11,14H,4-5,9-10,12-13H2,1-3H3,(H,22,23)(H2,18,20,21);1H |
| InChIKey | QQIHKQAQDKOIPF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|