C16H31IN4S — CID 111511522
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine;hydroiodide (PubChem CID 111511522) has the molecular formula C16H31IN4S and a molecular weight of 438.42 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111511522 |
| Molecular Formula | C16H31IN4S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(6-methylheptan-2-yl)guanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N/C)NC(C)CCCC(C)C)s1.I |
| InChI | InChI=1S/C16H30N4S.HI/c1-6-14-10-18-15(21-14)11-19-16(17-5)20-13(4)9-7-8-12(2)3;/h10,12-13H,6-9,11H2,1-5H3,(H2,17,19,20);1H |
| InChIKey | SJLOIWCPWIYWTF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|