C17H31N5S — CID 111534806
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(3-methyl-2-pyrrolidin-1-ylbutyl)guanidine (PubChem CID 111534806) has the molecular formula C17H31N5S and a molecular weight of 337.54 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(3-methyl-2-pyrrolidin-1-ylbutyl)guanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(3-methyl-2-pyrrolidin-1-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111534806 |
| Molecular Formula | C17H31N5S |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(3-methyl-2-pyrrolidin-1-ylbutyl)guanidine |
| SMILES | CCc1cnc(CN/C(=N/C)NCC(C(C)C)N2CCCC2)s1 |
| InChI | InChI=1S/C17H31N5S/c1-5-14-10-19-16(23-14)12-21-17(18-4)20-11-15(13(2)3)22-8-6-7-9-22/h10,13,15H,5-9,11-12H2,1-4H3,(H2,18,20,21) |
| InChIKey | JTUCTFBBULSXIH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|