C19H33N5S — CID 111535843
1-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine (PubChem CID 111535843) has the molecular formula C19H33N5S and a molecular weight of 363.58 g/mol. Its IUPAC name is 1-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111535843 |
| Molecular Formula | C19H33N5S |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 1-[2-[bis(prop-2-enyl)amino]-3-methylbutyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine |
| SMILES | C=CCN(CC=C)C(CN/C(=N\C)NCc1ncc(CC)s1)C(C)C |
| InChI | InChI=1S/C19H33N5S/c1-7-10-24(11-8-2)17(15(4)5)13-22-19(20-6)23-14-18-21-12-16(9-3)25-18/h7-8,12,15,17H,1-2,9-11,13-14H2,3-6H3,(H2,20,22,23) |
| InChIKey | SJQBSRPFSSDQMV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|