C20H31N5O2S — CID 111535110
1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine (PubChem CID 111535110) has the molecular formula C20H31N5O2S and a molecular weight of 405.57 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111535110 |
| Molecular Formula | C20H31N5O2S |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylguanidine |
| SMILES | CCc1cnc(CN/C(=N\C)NCC(c2ccc(OC)c(OC)c2)N(C)C)s1 |
| InChI | InChI=1S/C20H31N5O2S/c1-7-15-11-22-19(28-15)13-24-20(21-2)23-12-16(25(3)4)14-8-9-17(26-5)18(10-14)27-6/h8-11,16H,7,12-13H2,1-6H3,(H2,21,23,24) |
| InChIKey | TXGAYXFPZQTTOR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|