C17H30N4O2 — CID 111126649
1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-2-methyl-3-propan-2-ylguanidine (PubChem CID 111126649) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-2-methyl-3-propan-2-ylguanidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-2-methyl-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111126649 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-2-methyl-3-propan-2-ylguanidine |
| SMILES | C/N=C(/NCC(c1ccc(OC)c(OC)c1)N(C)C)NC(C)C |
| InChI | InChI=1S/C17H30N4O2/c1-12(2)20-17(18-3)19-11-14(21(4)5)13-8-9-15(22-6)16(10-13)23-7/h8-10,12,14H,11H2,1-7H3,(H2,18,19,20) |
| InChIKey | ZSXYXCLCPKDNQE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|