C24H36IN5O3 — CID 111873590
4-[[[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111873590) has the molecular formula C24H36IN5O3 and a molecular weight of 569.49 g/mol. Its IUPAC name is 4-[[[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111873590 |
| Molecular Formula | C24H36IN5O3 |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 4-[[[N-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N(C)C)cc1)NCC(c1ccc(OC)c(OC)c1)N(C)C.I |
| InChI | InChI=1S/C24H35N5O3.HI/c1-25-24(26-15-17-8-10-18(11-9-17)23(30)29(4)5)27-16-20(28(2)3)19-12-13-21(31-6)22(14-19)32-7;/h8-14,20H,15-16H2,1-7H3,(H2,25,26,27);1H |
| InChIKey | DAXCECCTAYZHKB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|