C15H24N6S — CID 111536265
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine (PubChem CID 111536265) has the molecular formula C15H24N6S and a molecular weight of 320.47 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111536265 |
| Molecular Formula | C15H24N6S |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]guanidine |
| SMILES | CCc1cnc(CN/C(=N/C)NCCCc2cnn(C)c2)s1 |
| InChI | InChI=1S/C15H24N6S/c1-4-13-9-18-14(22-13)10-19-15(16-2)17-7-5-6-12-8-20-21(3)11-12/h8-9,11H,4-7,10H2,1-3H3,(H2,16,17,19) |
| InChIKey | DPFQYRPUBYSWEM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|