C20H27IN4O2S — CID 111556679
N-[3-[[N'-methyl-N-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111556679) has the molecular formula C20H27IN4O2S and a molecular weight of 514.43 g/mol. Its IUPAC name is N-[3-[[N'-methyl-N-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N'-methyl-N-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111556679 |
| Molecular Formula | C20H27IN4O2S |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | N-[3-[[N'-methyl-N-[(2-prop-2-enoxyphenyl)methyl]carbamimidoyl]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | C=CCOc1ccccc1CN/C(=N/C)NCCCNC(=O)c1cccs1.I |
| InChI | InChI=1S/C20H26N4O2S.HI/c1-3-13-26-17-9-5-4-8-16(17)15-24-20(21-2)23-12-7-11-22-19(25)18-10-6-14-27-18;/h3-6,8-10,14H,1,7,11-13,15H2,2H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | FXHASYCHIAREBZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|