C15H18F4N6 — CID 111889833
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111889833) has the molecular formula C15H18F4N6 and a molecular weight of 358.34 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111889833 |
| Molecular Formula | C15H18F4N6 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(F)cc1C(F)(F)F)NCc1nnc(C)n1C |
| InChI | InChI=1S/C15H18F4N6/c1-9-23-24-13(25(9)3)8-22-14(20-2)21-7-10-4-5-11(16)6-12(10)15(17,18)19/h4-6H,7-8H2,1-3H3,(H2,20,21,22) |
| InChIKey | FHOIDCCSQSGOOC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|