C17H26FIN6 — CID 111624921
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide (PubChem CID 111624921) has the molecular formula C17H26FIN6 and a molecular weight of 460.34 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111624921 |
| Molecular Formula | C17H26FIN6 |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nnc(C)n1C)NCC(C)(C)c1cccc(F)c1.I |
| InChI | InChI=1S/C17H25FN6.HI/c1-12-22-23-15(24(12)5)10-20-16(19-4)21-11-17(2,3)13-7-6-8-14(18)9-13;/h6-9H,10-11H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | AIZRBGIGGNPTHD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|