C12H25IN6S — CID 111609935
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111609935) has the molecular formula C12H25IN6S and a molecular weight of 412.35 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111609935 |
| Molecular Formula | C12H25IN6S |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc(C)n1C)NCC(C)(C)SC.I |
| InChI | InChI=1S/C12H24N6S.HI/c1-9-16-17-10(18(9)5)7-14-11(13-4)15-8-12(2,3)19-6;/h7-8H2,1-6H3,(H2,13,14,15);1H |
| InChIKey | XXTFBNAAAMKYPC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|