C17H23ClN4S — CID 111175049
1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-[(2-chlorophenyl)methyl]-2-methylguanidine (PubChem CID 111175049) has the molecular formula C17H23ClN4S and a molecular weight of 350.92 g/mol. Its IUPAC name is 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-[(2-chlorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-[(2-chlorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111175049 |
| Molecular Formula | C17H23ClN4S |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-3-[(2-chlorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1csc(C(C)(C)C)n1)NCc1ccccc1Cl |
| InChI | InChI=1S/C17H23ClN4S/c1-17(2,3)15-22-13(11-23-15)10-21-16(19-4)20-9-12-7-5-6-8-14(12)18/h5-8,11H,9-10H2,1-4H3,(H2,19,20,21) |
| InChIKey | DTXFDNXWZVDBRL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|