C20H27F2N3O2S — CID 111673536
1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine (PubChem CID 111673536) has the molecular formula C20H27F2N3O2S and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111673536 |
| Molecular Formula | C20H27F2N3O2S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-2-methyl-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
| SMILES | C/N=C(/NCCc1ccc(OC)c(OC(F)F)c1)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C20H27F2N3O2S/c1-14(11-16-5-4-10-28-16)13-25-20(23-2)24-9-8-15-6-7-17(26-3)18(12-15)27-19(21)22/h4-7,10,12,14,19H,8-9,11,13H2,1-3H3,(H2,23,24,25) |
| InChIKey | JGCNDZPMELIWMA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|