C24H37IN4O3 — CID 111767458
2-methyl-1-[2-methyl-2-(1-phenylethylamino)propyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111767458) has the molecular formula C24H37IN4O3 and a molecular weight of 556.49 g/mol. Its IUPAC name is 2-methyl-1-[2-methyl-2-(1-phenylethylamino)propyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-methyl-2-(1-phenylethylamino)propyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111767458 |
| Molecular Formula | C24H37IN4O3 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-methyl-1-[2-methyl-2-(1-phenylethylamino)propyl]-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)c(OC)c1)NCC(C)(C)NC(C)c1ccccc1.I |
| InChI | InChI=1S/C24H36N4O3.HI/c1-17(19-11-9-8-10-12-19)28-24(2,3)16-27-23(25-4)26-15-18-13-20(29-5)22(31-7)21(14-18)30-6;/h8-14,17,28H,15-16H2,1-7H3,(H2,25,26,27);1H |
| InChIKey | PUYMVEIJWRAIME-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|