C21H30IN3O3S — CID 111496215
2-methyl-1-(2-phenylsulfanylpropyl)-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111496215) has the molecular formula C21H30IN3O3S and a molecular weight of 531.46 g/mol. Its IUPAC name is 2-methyl-1-(2-phenylsulfanylpropyl)-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-phenylsulfanylpropyl)-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111496215 |
| Molecular Formula | C21H30IN3O3S |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | 2-methyl-1-(2-phenylsulfanylpropyl)-3-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)c(OC)c1)NCC(C)Sc1ccccc1.I |
| InChI | InChI=1S/C21H29N3O3S.HI/c1-15(28-17-9-7-6-8-10-17)13-23-21(22-2)24-14-16-11-18(25-3)20(27-5)19(12-16)26-4;/h6-12,15H,13-14H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | HBFWNBHWLMMBFA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|