C17H28N4 — CID 111111884
1-cyclopropyl-2-methyl-3-[2-methyl-2-(1-phenylethylamino)propyl]guanidine (PubChem CID 111111884) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-cyclopropyl-2-methyl-3-[2-methyl-2-(1-phenylethylamino)propyl]guanidine.
| Compound Name | 1-cyclopropyl-2-methyl-3-[2-methyl-2-(1-phenylethylamino)propyl]guanidine |
|---|---|
| PubChem CID | 111111884 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-cyclopropyl-2-methyl-3-[2-methyl-2-(1-phenylethylamino)propyl]guanidine |
| SMILES | C/N=C(/NCC(C)(C)NC(C)c1ccccc1)NC1CC1 |
| InChI | InChI=1S/C17H28N4/c1-13(14-8-6-5-7-9-14)21-17(2,3)12-19-16(18-4)20-15-10-11-15/h5-9,13,15,21H,10-12H2,1-4H3,(H2,18,19,20) |
| InChIKey | FGKKNTMKLBHFDD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|