C20H25BrIN3O3 — CID 111950588
1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 111950588) has the molecular formula C20H25BrIN3O3 and a molecular weight of 562.25 g/mol. Its IUPAC name is 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111950588 |
| Molecular Formula | C20H25BrIN3O3 |
| Molecular Weight | 562.25 g/mol |
| Exact Mass | 561.01 |
| IUPAC Name | 1-[(3-bromo-4,5-dimethoxyphenyl)methyl]-3-(2,3-dihydro-1-benzofuran-2-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(Br)c(OC)c(OC)c1)NCC1Cc2ccccc2O1.I |
| InChI | InChI=1S/C20H24BrN3O3.HI/c1-22-20(24-12-15-10-14-6-4-5-7-17(14)27-15)23-11-13-8-16(21)19(26-3)18(9-13)25-2;/h4-9,15H,10-12H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | PAZHOFFTXJOESM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|