C16H24BrN3O — CID 111145552
N-[(3-bromo-4-methoxyphenyl)methyl]-N',3-dimethylpiperidine-1-carboximidamide (PubChem CID 111145552) has the molecular formula C16H24BrN3O and a molecular weight of 354.29 g/mol. Its IUPAC name is N-[(3-bromo-4-methoxyphenyl)methyl]-N',3-dimethylpiperidine-1-carboximidamide.
| Compound Name | N-[(3-bromo-4-methoxyphenyl)methyl]-N',3-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111145552 |
| Molecular Formula | C16H24BrN3O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[(3-bromo-4-methoxyphenyl)methyl]-N',3-dimethylpiperidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(OC)c(Br)c1)N1CCCC(C)C1 |
| InChI | InChI=1S/C16H24BrN3O/c1-12-5-4-8-20(11-12)16(18-2)19-10-13-6-7-15(21-3)14(17)9-13/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H,18,19) |
| InChIKey | JLSAFTAGZHJKKS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|