C23H24ClN7O — CID 111588089
1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111588089) has the molecular formula C23H24ClN7O and a molecular weight of 449.95 g/mol. Its IUPAC name is 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111588089 |
| Molecular Formula | C23H24ClN7O |
| Molecular Weight | 449.95 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCc1nc(-c2cccc(Cl)c2)no1)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C23H24ClN7O/c1-25-23(27-15-18-6-2-3-7-19(18)16-31-13-5-11-28-31)26-12-10-21-29-22(30-32-21)17-8-4-9-20(24)14-17/h2-9,11,13-14H,10,12,15-16H2,1H3,(H2,25,26,27) |
| InChIKey | KAHUDIOGYULDDI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.95 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|