C15H23ClN4OS — CID 109485360
N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide (PubChem CID 109485360) has the molecular formula C15H23ClN4OS and a molecular weight of 342.90 g/mol. Its IUPAC name is N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide.
| Compound Name | N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485360 |
| Molecular Formula | C15H23ClN4OS |
| Molecular Weight | 342.90 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCCOc2ncccc2Cl)CCS1 |
| InChI | InChI=1S/C15H23ClN4OS/c1-3-12-11-20(8-10-22-12)15(17-2)19-7-9-21-14-13(16)5-4-6-18-14/h4-6,12H,3,7-11H2,1-2H3,(H,17,19) |
| InChIKey | POGNMJIHUMYRKB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.90 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|