C17H28IN5O4S2 — CID 109485815
N,2-diethyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485815) has the molecular formula C17H28IN5O4S2 and a molecular weight of 557.48 g/mol. Its IUPAC name is N,2-diethyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N,2-diethyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109485815 |
| Molecular Formula | C17H28IN5O4S2 |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | N,2-diethyl-N'-[2-[(3-nitrophenyl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc([N+](=O)[O-])c1)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C17H27N5O4S2.HI/c1-3-15-13-21(10-11-27-15)17(18-4-2)19-8-9-20-28(25,26)16-7-5-6-14(12-16)22(23)24;/h5-7,12,15,20H,3-4,8-11,13H2,1-2H3,(H,18,19);1H |
| InChIKey | MHJXOVXKNFQXKW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|