C17H25BrIN3O3 — CID 109386956
2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109386956) has the molecular formula C17H25BrIN3O3 and a molecular weight of 526.21 g/mol. Its IUPAC name is 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109386956 |
| Molecular Formula | C17H25BrIN3O3 |
| Molecular Weight | 526.21 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)c2c(c1)OCO2)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C17H24BrN3O3.HI/c1-3-19-17(21(2)9-12-4-5-22-10-12)20-8-13-6-14(18)16-15(7-13)23-11-24-16;/h6-7,12H,3-5,8-11H2,1-2H3,(H,19,20);1H |
| InChIKey | HLBLABMNFIUYSJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|