C17H24BrN3O3 — CID 119151001
2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-ethyl-3-(oxolan-3-ylmethyl)guanidine (PubChem CID 119151001) has the molecular formula C17H24BrN3O3 and a molecular weight of 398.30 g/mol. Its IUPAC name is 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-ethyl-3-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-ethyl-3-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119151001 |
| Molecular Formula | C17H24BrN3O3 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-[(5-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-1-ethyl-3-(oxolan-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(Br)c2c(c1)OCCO2)NCC1CCOC1 |
| InChI | InChI=1S/C17H24BrN3O3/c1-2-19-17(20-9-12-3-4-22-11-12)21-10-13-7-14(18)16-15(8-13)23-5-6-24-16/h7-8,12H,2-6,9-11H2,1H3,(H2,19,20,21) |
| InChIKey | PPJHJVZQLHVXJU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|