C19H29ClIN3O3 — CID 109382811
2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 109382811) has the molecular formula C19H29ClIN3O3 and a molecular weight of 509.82 g/mol. Its IUPAC name is 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109382811 |
| Molecular Formula | C19H29ClIN3O3 |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-ethyl-1-methyl-1-(oxolan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Cl)c2c(c1)OCCCO2)N(C)CC1CCOC1.I |
| InChI | InChI=1S/C19H28ClN3O3.HI/c1-3-21-19(23(2)12-14-5-8-24-13-14)22-11-15-9-16(20)18-17(10-15)25-6-4-7-26-18;/h9-10,14H,3-8,11-13H2,1-2H3,(H,21,22);1H |
| InChIKey | HAIGPHURCMWLQY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|