C16H23BrIN3O2 — CID 110990052
2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-cyclopentyl-3-ethylguanidine;hydroiodide (PubChem CID 110990052) has the molecular formula C16H23BrIN3O2 and a molecular weight of 496.19 g/mol. Its IUPAC name is 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-cyclopentyl-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-cyclopentyl-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110990052 |
| Molecular Formula | C16H23BrIN3O2 |
| Molecular Weight | 496.19 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-cyclopentyl-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)c2c(c1)OCO2)NC1CCCC1.I |
| InChI | InChI=1S/C16H22BrN3O2.HI/c1-2-18-16(20-12-5-3-4-6-12)19-9-11-7-13(17)15-14(8-11)21-10-22-15;/h7-8,12H,2-6,9-10H2,1H3,(H2,18,19,20);1H |
| InChIKey | FQDGDVQZRDYJCM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|