C18H20BrIN6O2 — CID 111013614
2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111013614) has the molecular formula C18H20BrIN6O2 and a molecular weight of 559.21 g/mol. Its IUPAC name is 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111013614 |
| Molecular Formula | C18H20BrIN6O2 |
| Molecular Weight | 559.21 g/mol |
| Exact Mass | 557.99 |
| IUPAC Name | 2-[(7-bromo-1,3-benzodioxol-5-yl)methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)c2c(c1)OCO2)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C18H19BrN6O2.HI/c1-2-20-18(22-10-16-24-23-15-5-3-4-6-25(15)16)21-9-12-7-13(19)17-14(8-12)26-11-27-17;/h3-8H,2,9-11H2,1H3,(H2,20,21,22);1H |
| InChIKey | NEGFRTHHQKUNHZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|