C12H17N3O2 — CID 81240575
4-amino-N-(oxan-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 81240575) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-amino-N-(oxan-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 4-amino-N-(oxan-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 81240575 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 4-amino-N-(oxan-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | Nc1ccncc1C(=O)NCC1CCCOC1 |
| InChI | InChI=1S/C12H17N3O2/c13-11-3-4-14-7-10(11)12(16)15-6-9-2-1-5-17-8-9/h3-4,7,9H,1-2,5-6,8H2,(H2,13,14)(H,15,16) |
| InChIKey | ABYCRFUWUGOYBH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |