C11H17N5O2 — CID 62249832
6-hydrazinyl-N-(oxan-3-ylmethyl)pyridazine-3-carboxamide (PubChem CID 62249832) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 6-hydrazinyl-N-(oxan-3-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-(oxan-3-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62249832 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 6-hydrazinyl-N-(oxan-3-ylmethyl)pyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)NCC2CCCOC2)nn1 |
| InChI | InChI=1S/C11H17N5O2/c12-14-10-4-3-9(15-16-10)11(17)13-6-8-2-1-5-18-7-8/h3-4,8H,1-2,5-7,12H2,(H,13,17)(H,14,16) |
| InChIKey | HEFVIASFMSGGIJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|