C15H15ClN2O4S — CID 167200814
2-(2-chlorophenyl)-N-[4-(hydroxymethyl)-3-sulfamoylphenyl]acetamide (PubChem CID 167200814) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[4-(hydroxymethyl)-3-sulfamoylphenyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[4-(hydroxymethyl)-3-sulfamoylphenyl]acetamide |
|---|---|
| PubChem CID | 167200814 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[4-(hydroxymethyl)-3-sulfamoylphenyl]acetamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)Cc2ccccc2Cl)ccc1CO |
| InChI | InChI=1S/C15H15ClN2O4S/c16-13-4-2-1-3-10(13)7-15(20)18-12-6-5-11(9-19)14(8-12)23(17,21)22/h1-6,8,19H,7,9H2,(H,18,20)(H2,17,21,22) |
| InChIKey | BQACYEBHQILFRO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |