C17H13Cl2N3O3S — CID 156572300
2-(2-chlorophenyl)-N-(3-chloro-5-sulfamoylisoquinolin-7-yl)acetamide (PubChem CID 156572300) has the molecular formula C17H13Cl2N3O3S and a molecular weight of 410.28 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(3-chloro-5-sulfamoylisoquinolin-7-yl)acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-(3-chloro-5-sulfamoylisoquinolin-7-yl)acetamide |
|---|---|
| PubChem CID | 156572300 |
| Molecular Formula | C17H13Cl2N3O3S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(3-chloro-5-sulfamoylisoquinolin-7-yl)acetamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)Cc2ccccc2Cl)cc2cnc(Cl)cc12 |
| InChI | InChI=1S/C17H13Cl2N3O3S/c18-14-4-2-1-3-10(14)6-17(23)22-12-5-11-9-21-16(19)8-13(11)15(7-12)26(20,24)25/h1-5,7-9H,6H2,(H,22,23)(H2,20,24,25) |
| InChIKey | XCHGRSGDBFTKIG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|