C18H16ClN3O4S — CID 156572293
2-(2-chlorophenyl)-N-(1-methoxy-5-sulfamoylisoquinolin-7-yl)acetamide (PubChem CID 156572293) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(1-methoxy-5-sulfamoylisoquinolin-7-yl)acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-(1-methoxy-5-sulfamoylisoquinolin-7-yl)acetamide |
|---|---|
| PubChem CID | 156572293 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(1-methoxy-5-sulfamoylisoquinolin-7-yl)acetamide |
| SMILES | COc1nccc2c(S(N)(=O)=O)cc(NC(=O)Cc3ccccc3Cl)cc12 |
| InChI | InChI=1S/C18H16ClN3O4S/c1-26-18-14-9-12(10-16(27(20,24)25)13(14)6-7-21-18)22-17(23)8-11-4-2-3-5-15(11)19/h2-7,9-10H,8H2,1H3,(H,22,23)(H2,20,24,25) |
| InChIKey | WNRZNMNPUGJWFB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |