C18H16ClN3O5S — CID 156572330
2-(2-chloro-6-hydroxyphenyl)-N-(1-methoxy-5-sulfamoylisoquinolin-7-yl)acetamide (PubChem CID 156572330) has the molecular formula C18H16ClN3O5S and a molecular weight of 421.86 g/mol. Its IUPAC name is 2-(2-chloro-6-hydroxyphenyl)-N-(1-methoxy-5-sulfamoylisoquinolin-7-yl)acetamide.
| Compound Name | 2-(2-chloro-6-hydroxyphenyl)-N-(1-methoxy-5-sulfamoylisoquinolin-7-yl)acetamide |
|---|---|
| PubChem CID | 156572330 |
| Molecular Formula | C18H16ClN3O5S |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 2-(2-chloro-6-hydroxyphenyl)-N-(1-methoxy-5-sulfamoylisoquinolin-7-yl)acetamide |
| SMILES | COc1nccc2c(S(N)(=O)=O)cc(NC(=O)Cc3c(O)cccc3Cl)cc12 |
| InChI | InChI=1S/C18H16ClN3O5S/c1-27-18-12-7-10(8-16(28(20,25)26)11(12)5-6-21-18)22-17(24)9-13-14(19)3-2-4-15(13)23/h2-8,23H,9H2,1H3,(H,22,24)(H2,20,25,26) |
| InChIKey | CUCMXSUIKZMCKQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |