C20H16ClF2N3O4S — CID 164596481
2-(2-chloro-6-fluorophenyl)-N-[4-[(6-fluoro-3-pyridinyl)oxymethyl]-3-sulfamoylphenyl]acetamide (PubChem CID 164596481) has the molecular formula C20H16ClF2N3O4S and a molecular weight of 467.88 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[4-[(6-fluoro-3-pyridinyl)oxymethyl]-3-sulfamoylphenyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[4-[(6-fluoro-3-pyridinyl)oxymethyl]-3-sulfamoylphenyl]acetamide |
|---|---|
| PubChem CID | 164596481 |
| Molecular Formula | C20H16ClF2N3O4S |
| Molecular Weight | 467.88 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[4-[(6-fluoro-3-pyridinyl)oxymethyl]-3-sulfamoylphenyl]acetamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)Cc2c(F)cccc2Cl)ccc1COc1ccc(F)nc1 |
| InChI | InChI=1S/C20H16ClF2N3O4S/c21-16-2-1-3-17(22)15(16)9-20(27)26-13-5-4-12(18(8-13)31(24,28)29)11-30-14-6-7-19(23)25-10-14/h1-8,10H,9,11H2,(H,26,27)(H2,24,28,29) |
| InChIKey | QRFDFTICEGPJDW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.88 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|