C21H19ClFN3O4S — CID 164596523
2-(2-chlorophenyl)-N-[4-[1-[(6-fluoro-3-pyridinyl)oxy]ethyl]-3-sulfamoylphenyl]acetamide (PubChem CID 164596523) has the molecular formula C21H19ClFN3O4S and a molecular weight of 463.92 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[4-[1-[(6-fluoro-3-pyridinyl)oxy]ethyl]-3-sulfamoylphenyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[4-[1-[(6-fluoro-3-pyridinyl)oxy]ethyl]-3-sulfamoylphenyl]acetamide |
|---|---|
| PubChem CID | 164596523 |
| Molecular Formula | C21H19ClFN3O4S |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[4-[1-[(6-fluoro-3-pyridinyl)oxy]ethyl]-3-sulfamoylphenyl]acetamide |
| SMILES | CC(Oc1ccc(F)nc1)c1ccc(NC(=O)Cc2ccccc2Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C21H19ClFN3O4S/c1-13(30-16-7-9-20(23)25-12-16)17-8-6-15(11-19(17)31(24,28)29)26-21(27)10-14-4-2-3-5-18(14)22/h2-9,11-13H,10H2,1H3,(H,26,27)(H2,24,28,29) |
| InChIKey | ARPYXQVQTQDDRU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|