C21H18ClFN2O2S — CID 167200135
N-[3-aminosulfanyl-4-[(4-fluorophenoxy)methyl]phenyl]-2-(2-chlorophenyl)acetamide (PubChem CID 167200135) has the molecular formula C21H18ClFN2O2S and a molecular weight of 416.91 g/mol. Its IUPAC name is N-[3-aminosulfanyl-4-[(4-fluorophenoxy)methyl]phenyl]-2-(2-chlorophenyl)acetamide.
| Compound Name | N-[3-aminosulfanyl-4-[(4-fluorophenoxy)methyl]phenyl]-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 167200135 |
| Molecular Formula | C21H18ClFN2O2S |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[3-aminosulfanyl-4-[(4-fluorophenoxy)methyl]phenyl]-2-(2-chlorophenyl)acetamide |
| SMILES | NSc1cc(NC(=O)Cc2ccccc2Cl)ccc1COc1ccc(F)cc1 |
| InChI | InChI=1S/C21H18ClFN2O2S/c22-19-4-2-1-3-14(19)11-21(26)25-17-8-5-15(20(12-17)28-24)13-27-18-9-6-16(23)7-10-18/h1-10,12H,11,13,24H2,(H,25,26) |
| InChIKey | PEMRXPMDFUQUPU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|