C18H13ClN4OS — CID 156572382
N-(5-aminosulfanyl-1-cyanoisoquinolin-7-yl)-2-(2-chlorophenyl)acetamide (PubChem CID 156572382) has the molecular formula C18H13ClN4OS and a molecular weight of 368.85 g/mol. Its IUPAC name is N-(5-aminosulfanyl-1-cyanoisoquinolin-7-yl)-2-(2-chlorophenyl)acetamide.
| Compound Name | N-(5-aminosulfanyl-1-cyanoisoquinolin-7-yl)-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 156572382 |
| Molecular Formula | C18H13ClN4OS |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | N-(5-aminosulfanyl-1-cyanoisoquinolin-7-yl)-2-(2-chlorophenyl)acetamide |
| SMILES | N#Cc1nccc2c(SN)cc(NC(=O)Cc3ccccc3Cl)cc12 |
| InChI | InChI=1S/C18H13ClN4OS/c19-15-4-2-1-3-11(15)7-18(24)23-12-8-14-13(17(9-12)25-21)5-6-22-16(14)10-20/h1-6,8-9H,7,21H2,(H,23,24) |
| InChIKey | RZWSLCVANNHQCV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|