C21H24ClN3OS — CID 156572452
N-[5-aminosulfanyl-2-(cyclopropylmethyl)-3,4-dihydro-1H-isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide (PubChem CID 156572452) has the molecular formula C21H24ClN3OS and a molecular weight of 401.96 g/mol. Its IUPAC name is N-[5-aminosulfanyl-2-(cyclopropylmethyl)-3,4-dihydro-1H-isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide.
| Compound Name | N-[5-aminosulfanyl-2-(cyclopropylmethyl)-3,4-dihydro-1H-isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 156572452 |
| Molecular Formula | C21H24ClN3OS |
| Molecular Weight | 401.96 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[5-aminosulfanyl-2-(cyclopropylmethyl)-3,4-dihydro-1H-isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide |
| SMILES | NSc1cc(NC(=O)Cc2ccccc2Cl)cc2c1CCN(CC1CC1)C2 |
| InChI | InChI=1S/C21H24ClN3OS/c22-19-4-2-1-3-15(19)10-21(26)24-17-9-16-13-25(12-14-5-6-14)8-7-18(16)20(11-17)27-23/h1-4,9,11,14H,5-8,10,12-13,23H2,(H,24,26) |
| InChIKey | RBURZJNWEQUBPP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.96 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|