C27H29ClN4O3S — CID 156572155
N-[2-benzyl-5-[(E)-dimethylaminomethylideneamino]sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide (PubChem CID 156572155) has the molecular formula C27H29ClN4O3S and a molecular weight of 525.07 g/mol. Its IUPAC name is N-[2-benzyl-5-[(E)-dimethylaminomethylideneamino]sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide.
| Compound Name | N-[2-benzyl-5-[(E)-dimethylaminomethylideneamino]sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 156572155 |
| Molecular Formula | C27H29ClN4O3S |
| Molecular Weight | 525.07 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | N-[2-benzyl-5-[(E)-dimethylaminomethylideneamino]sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide |
| SMILES | CN(C)/C=N/S(=O)(=O)c1cc(NC(=O)Cc2ccccc2Cl)cc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C27H29ClN4O3S/c1-31(2)19-29-36(34,35)26-16-23(30-27(33)15-21-10-6-7-11-25(21)28)14-22-18-32(13-12-24(22)26)17-20-8-4-3-5-9-20/h3-11,14,16,19H,12-13,15,17-18H2,1-2H3,(H,30,33)/b29-19+ |
| InChIKey | ZVRVDONQEQQWIQ-VUTHCHCSSA-N |
| XLogP | 4.36 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.07 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|