C22H22ClN3O2S — CID 156572384
N-[5-aminosulfanyl-1-(2-cyclopropylethoxy)isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide (PubChem CID 156572384) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is N-[5-aminosulfanyl-1-(2-cyclopropylethoxy)isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide.
| Compound Name | N-[5-aminosulfanyl-1-(2-cyclopropylethoxy)isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 156572384 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-[5-aminosulfanyl-1-(2-cyclopropylethoxy)isoquinolin-7-yl]-2-(2-chlorophenyl)acetamide |
| SMILES | NSc1cc(NC(=O)Cc2ccccc2Cl)cc2c(OCCC3CC3)nccc12 |
| InChI | InChI=1S/C22H22ClN3O2S/c23-19-4-2-1-3-15(19)11-21(27)26-16-12-18-17(20(13-16)29-24)7-9-25-22(18)28-10-8-14-5-6-14/h1-4,7,9,12-14H,5-6,8,10-11,24H2,(H,26,27) |
| InChIKey | IJPGGKNTSGQHIZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|