C21H17ClF2N2O2S — CID 167200778
N-[3-aminosulfanyl-4-[(4-fluorophenoxy)methyl]phenyl]-2-(2-chloro-4-fluorophenyl)acetamide (PubChem CID 167200778) has the molecular formula C21H17ClF2N2O2S and a molecular weight of 434.90 g/mol. Its IUPAC name is N-[3-aminosulfanyl-4-[(4-fluorophenoxy)methyl]phenyl]-2-(2-chloro-4-fluorophenyl)acetamide.
| Compound Name | N-[3-aminosulfanyl-4-[(4-fluorophenoxy)methyl]phenyl]-2-(2-chloro-4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 167200778 |
| Molecular Formula | C21H17ClF2N2O2S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | N-[3-aminosulfanyl-4-[(4-fluorophenoxy)methyl]phenyl]-2-(2-chloro-4-fluorophenyl)acetamide |
| SMILES | NSc1cc(NC(=O)Cc2ccc(F)cc2Cl)ccc1COc1ccc(F)cc1 |
| InChI | InChI=1S/C21H17ClF2N2O2S/c22-19-10-16(24)3-1-13(19)9-21(27)26-17-6-2-14(20(11-17)29-25)12-28-18-7-4-15(23)5-8-18/h1-8,10-11H,9,12,25H2,(H,26,27) |
| InChIKey | JOUSEMVBVXDYDJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|