C15H14ClFN2O2 — CID 29046897
N-(3-amino-4-chlorophenyl)-3-(4-fluorophenoxy)propanamide (PubChem CID 29046897) has the molecular formula C15H14ClFN2O2 and a molecular weight of 308.74 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-3-(4-fluorophenoxy)propanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-3-(4-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 29046897 |
| Molecular Formula | C15H14ClFN2O2 |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-3-(4-fluorophenoxy)propanamide |
| SMILES | Nc1cc(NC(=O)CCOc2ccc(F)cc2)ccc1Cl |
| InChI | InChI=1S/C15H14ClFN2O2/c16-13-6-3-11(9-14(13)18)19-15(20)7-8-21-12-4-1-10(17)2-5-12/h1-6,9H,7-8,18H2,(H,19,20) |
| InChIKey | NAMRSMNIVLGGRB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|