C15H14BrClN2O2 — CID 28531859
N-(3-amino-4-chlorophenyl)-3-(3-bromophenoxy)propanamide (PubChem CID 28531859) has the molecular formula C15H14BrClN2O2 and a molecular weight of 369.65 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-3-(3-bromophenoxy)propanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-3-(3-bromophenoxy)propanamide |
|---|---|
| PubChem CID | 28531859 |
| Molecular Formula | C15H14BrClN2O2 |
| Molecular Weight | 369.65 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-3-(3-bromophenoxy)propanamide |
| SMILES | Nc1cc(NC(=O)CCOc2cccc(Br)c2)ccc1Cl |
| InChI | InChI=1S/C15H14BrClN2O2/c16-10-2-1-3-12(8-10)21-7-6-15(20)19-11-4-5-13(17)14(18)9-11/h1-5,8-9H,6-7,18H2,(H,19,20) |
| InChIKey | VJZWPVZSTPMSAU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.65 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|