C15H14Cl2N2O2 — CID 61090468
3-(3-aminophenoxy)-N-(3,5-dichlorophenyl)propanamide (PubChem CID 61090468) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 3-(3-aminophenoxy)-N-(3,5-dichlorophenyl)propanamide.
| Compound Name | 3-(3-aminophenoxy)-N-(3,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 61090468 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 3-(3-aminophenoxy)-N-(3,5-dichlorophenyl)propanamide |
| SMILES | Nc1cccc(OCCC(=O)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c16-10-6-11(17)8-13(7-10)19-15(20)4-5-21-14-3-1-2-12(18)9-14/h1-3,6-9H,4-5,18H2,(H,19,20) |
| InChIKey | LAIFEXAPUILCTC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|