C15H18N4O2 — CID 61092948
3-(3-aminophenoxy)-N-(4,6-dimethylpyrimidin-2-yl)propanamide (PubChem CID 61092948) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 3-(3-aminophenoxy)-N-(4,6-dimethylpyrimidin-2-yl)propanamide.
| Compound Name | 3-(3-aminophenoxy)-N-(4,6-dimethylpyrimidin-2-yl)propanamide |
|---|---|
| PubChem CID | 61092948 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-(3-aminophenoxy)-N-(4,6-dimethylpyrimidin-2-yl)propanamide |
| SMILES | Cc1cc(C)nc(NC(=O)CCOc2cccc(N)c2)n1 |
| InChI | InChI=1S/C15H18N4O2/c1-10-8-11(2)18-15(17-10)19-14(20)6-7-21-13-5-3-4-12(16)9-13/h3-5,8-9H,6-7,16H2,1-2H3,(H,17,18,19,20) |
| InChIKey | BXJTUFRUHOSXNJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|