C14H12Cl2N2O — CID 28712382
2-(3-aminophenyl)-N-(3,5-dichlorophenyl)acetamide (PubChem CID 28712382) has the molecular formula C14H12Cl2N2O and a molecular weight of 295.17 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-(3-aminophenyl)-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 28712382 |
| Molecular Formula | C14H12Cl2N2O |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-(3-aminophenyl)-N-(3,5-dichlorophenyl)acetamide |
| SMILES | Nc1cccc(CC(=O)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C14H12Cl2N2O/c15-10-6-11(16)8-13(7-10)18-14(19)5-9-2-1-3-12(17)4-9/h1-4,6-8H,5,17H2,(H,18,19) |
| InChIKey | CJDFGAOFVXKOIA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|