C23H22ClN5O4S — CID 156803458
2-(2-chlorophenyl)-N-[3-[4-methyl-3-(oxomethylidene)piperazin-1-yl]-5-sulfamoylisoquinolin-7-yl]acetamide (PubChem CID 156803458) has the molecular formula C23H22ClN5O4S and a molecular weight of 499.98 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[3-[4-methyl-3-(oxomethylidene)piperazin-1-yl]-5-sulfamoylisoquinolin-7-yl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[3-[4-methyl-3-(oxomethylidene)piperazin-1-yl]-5-sulfamoylisoquinolin-7-yl]acetamide |
|---|---|
| PubChem CID | 156803458 |
| Molecular Formula | C23H22ClN5O4S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[3-[4-methyl-3-(oxomethylidene)piperazin-1-yl]-5-sulfamoylisoquinolin-7-yl]acetamide |
| SMILES | CN1CCN(c2cc3c(S(N)(=O)=O)cc(NC(=O)Cc4ccccc4Cl)cc3cn2)CC1=C=O |
| InChI | InChI=1S/C23H22ClN5O4S/c1-28-6-7-29(13-18(28)14-30)22-11-19-16(12-26-22)8-17(10-21(19)34(25,32)33)27-23(31)9-15-4-2-3-5-20(15)24/h2-5,8,10-12H,6-7,9,13H2,1H3,(H,27,31)(H2,25,32,33) |
| InChIKey | YXGAADJIEUYHED-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|