C19H15Cl2N3O3S — CID 134588591
2-(2-chlorophenyl)-N-[3-(5-chloro-3-pyridinyl)-5-sulfamoylphenyl]acetamide (PubChem CID 134588591) has the molecular formula C19H15Cl2N3O3S and a molecular weight of 436.32 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[3-(5-chloro-3-pyridinyl)-5-sulfamoylphenyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[3-(5-chloro-3-pyridinyl)-5-sulfamoylphenyl]acetamide |
|---|---|
| PubChem CID | 134588591 |
| Molecular Formula | C19H15Cl2N3O3S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[3-(5-chloro-3-pyridinyl)-5-sulfamoylphenyl]acetamide |
| SMILES | NS(=O)(=O)c1cc(NC(=O)Cc2ccccc2Cl)cc(-c2cncc(Cl)c2)c1 |
| InChI | InChI=1S/C19H15Cl2N3O3S/c20-15-5-14(10-23-11-15)13-6-16(9-17(7-13)28(22,26)27)24-19(25)8-12-3-1-2-4-18(12)21/h1-7,9-11H,8H2,(H,24,25)(H2,22,26,27) |
| InChIKey | WZFJCGZBRDRODD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |