C20H21ClN4O2 — CID 172629982
2-(2-chlorophenyl)-N-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]acetamide;formamide (PubChem CID 172629982) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]acetamide;formamide.
| Compound Name | 2-(2-chlorophenyl)-N-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]acetamide;formamide |
|---|---|
| PubChem CID | 172629982 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[3-methyl-5-(1-methylpyrazol-4-yl)phenyl]acetamide;formamide |
| SMILES | Cc1cc(NC(=O)Cc2ccccc2Cl)cc(-c2cnn(C)c2)c1.NC=O |
| InChI | InChI=1S/C19H18ClN3O.CH3NO/c1-13-7-15(16-11-21-23(2)12-16)9-17(8-13)22-19(24)10-14-5-3-4-6-18(14)20;2-1-3/h3-9,11-12H,10H2,1-2H3,(H,22,24);1H,(H2,2,3) |
| InChIKey | KKGVXWPBHDHBII-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|